C11H18O5 — CID 58100469
[2-(1-methylcyclopentyl)oxy-2-oxoethyl] 2-methoxyacetate (PubChem CID 58100469) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is [2-(1-methylcyclopentyl)oxy-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-(1-methylcyclopentyl)oxy-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 58100469 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | [2-(1-methylcyclopentyl)oxy-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)OC1(C)CCCC1 |
| InChI | InChI=1S/C11H18O5/c1-11(5-3-4-6-11)16-10(13)8-15-9(12)7-14-2/h3-8H2,1-2H3 |
| InChIKey | QZDCDNXYQLEDHE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |