C18H20ClN3O6S — CID 58101867
methyl 2-amino-3-[[2-[(2-chloro-4-methoxyphenyl)sulfonyl-methylamino]acetyl]amino]benzoate (PubChem CID 58101867) has the molecular formula C18H20ClN3O6S and a molecular weight of 441.89 g/mol. Its IUPAC name is methyl 2-amino-3-[[2-[(2-chloro-4-methoxyphenyl)sulfonyl-methylamino]acetyl]amino]benzoate.
| Compound Name | methyl 2-amino-3-[[2-[(2-chloro-4-methoxyphenyl)sulfonyl-methylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 58101867 |
| Molecular Formula | C18H20ClN3O6S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | methyl 2-amino-3-[[2-[(2-chloro-4-methoxyphenyl)sulfonyl-methylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CN(C)S(=O)(=O)c2ccc(OC)cc2Cl)c1N |
| InChI | InChI=1S/C18H20ClN3O6S/c1-22(29(25,26)15-8-7-11(27-2)9-13(15)19)10-16(23)21-14-6-4-5-12(17(14)20)18(24)28-3/h4-9H,10,20H2,1-3H3,(H,21,23) |
| InChIKey | OCCDZKZWGCRFFM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|