C22H27N3O6S — CID 58101721
methyl 2-amino-3-[[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]acetyl]amino]benzoate (PubChem CID 58101721) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is methyl 2-amino-3-[[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]acetyl]amino]benzoate.
| Compound Name | methyl 2-amino-3-[[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 58101721 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | methyl 2-amino-3-[[2-[cyclopropyl-(4-methoxy-2,6-dimethylphenyl)sulfonylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CN(C2CC2)S(=O)(=O)c2c(C)cc(OC)cc2C)c1N |
| InChI | InChI=1S/C22H27N3O6S/c1-13-10-16(30-3)11-14(2)21(13)32(28,29)25(15-8-9-15)12-19(26)24-18-7-5-6-17(20(18)23)22(27)31-4/h5-7,10-11,15H,8-9,12,23H2,1-4H3,(H,24,26) |
| InChIKey | QDLXPTYNTZSTKP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|