C15H20N6O — CID 58103107
6-[3-(2-pyrrolidin-1-ylethoxy)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 58103107) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 6-[3-(2-pyrrolidin-1-ylethoxy)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-[3-(2-pyrrolidin-1-ylethoxy)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 58103107 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 6-[3-(2-pyrrolidin-1-ylethoxy)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nnc(-c2cccc(OCCN3CCCC3)c2)c(N)n1 |
| InChI | InChI=1S/C15H20N6O/c16-14-13(19-20-15(17)18-14)11-4-3-5-12(10-11)22-9-8-21-6-1-2-7-21/h3-5,10H,1-2,6-9H2,(H4,16,17,18,20) |
| InChIKey | MGKSJMGGPKLFEX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |