C19H24N6O — CID 169397675
2,4-diamino-6-[3-(3-piperidin-1-ylpropoxy)phenyl]pyrimidine-5-carbonitrile (PubChem CID 169397675) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 2,4-diamino-6-[3-(3-piperidin-1-ylpropoxy)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[3-(3-piperidin-1-ylpropoxy)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169397675 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2,4-diamino-6-[3-(3-piperidin-1-ylpropoxy)phenyl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1cccc(OCCCN2CCCCC2)c1 |
| InChI | InChI=1S/C19H24N6O/c20-13-16-17(23-19(22)24-18(16)21)14-6-4-7-15(12-14)26-11-5-10-25-8-2-1-3-9-25/h4,6-7,12H,1-3,5,8-11H2,(H4,21,22,23,24) |
| InChIKey | HZJROASEPTUNMZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|