C8H5Cl2FN6 — CID 58103120
6-(2,6-dichloro-5-fluoro-3-pyridinyl)-1,2,4-triazine-3,5-diamine (PubChem CID 58103120) has the molecular formula C8H5Cl2FN6 and a molecular weight of 275.07 g/mol. Its IUPAC name is 6-(2,6-dichloro-5-fluoro-3-pyridinyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(2,6-dichloro-5-fluoro-3-pyridinyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 58103120 |
| Molecular Formula | C8H5Cl2FN6 |
| Molecular Weight | 275.07 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 6-(2,6-dichloro-5-fluoro-3-pyridinyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nnc(-c2cc(F)c(Cl)nc2Cl)c(N)n1 |
| InChI | InChI=1S/C8H5Cl2FN6/c9-5-2(1-3(11)6(10)14-5)4-7(12)15-8(13)17-16-4/h1H,(H4,12,13,15,17) |
| InChIKey | QZCHGZKTFUZXBL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.07 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|