C20H15F4N3O3 — CID 58104478
2-amino-6-fluoro-N-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 58104478) has the molecular formula C20H15F4N3O3 and a molecular weight of 421.35 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-6-fluoro-N-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58104478 |
| Molecular Formula | C20H15F4N3O3 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-amino-6-fluoro-N-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | Nc1nc(F)ccc1C(=O)NCc1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H15F4N3O3/c21-17-10-9-16(18(25)27-17)19(28)26-11-12-1-3-13(4-2-12)29-14-5-7-15(8-6-14)30-20(22,23)24/h1-10H,11H2,(H2,25,27)(H,26,28) |
| InChIKey | LXYJOSAHUSSFTP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|