C24H26FN3O2 — CID 66843737
2-amino-6-fluoro-N-[[4-(3-pentan-3-ylphenoxy)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 66843737) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-[[4-(3-pentan-3-ylphenoxy)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-6-fluoro-N-[[4-(3-pentan-3-ylphenoxy)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66843737 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-amino-6-fluoro-N-[[4-(3-pentan-3-ylphenoxy)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CCC(CC)c1cccc(Oc2ccc(CNC(=O)c3ccc(F)nc3N)cc2)c1 |
| InChI | InChI=1S/C24H26FN3O2/c1-3-17(4-2)18-6-5-7-20(14-18)30-19-10-8-16(9-11-19)15-27-24(29)21-12-13-22(25)28-23(21)26/h5-14,17H,3-4,15H2,1-2H3,(H2,26,28)(H,27,29) |
| InChIKey | IDCNFXQGHOTFAU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|