C24H27N3O3 — CID 66844381
2-amino-N-[[4-(3-butoxyphenoxy)phenyl]methyl]-6-methylpyridine-3-carboxamide (PubChem CID 66844381) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-amino-N-[[4-(3-butoxyphenoxy)phenyl]methyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 2-amino-N-[[4-(3-butoxyphenoxy)phenyl]methyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 66844381 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-amino-N-[[4-(3-butoxyphenoxy)phenyl]methyl]-6-methylpyridine-3-carboxamide |
| SMILES | CCCCOc1cccc(Oc2ccc(CNC(=O)c3ccc(C)nc3N)cc2)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-3-4-14-29-20-6-5-7-21(15-20)30-19-11-9-18(10-12-19)16-26-24(28)22-13-8-17(2)27-23(22)25/h5-13,15H,3-4,14,16H2,1-2H3,(H2,25,27)(H,26,28) |
| InChIKey | XUDWAJWBMGQRAX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|