C25H29N3O2 — CID 66843703
2-amino-6-methyl-N-[[4-[4-(3-methylbutyl)phenoxy]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 66843703) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-amino-6-methyl-N-[[4-[4-(3-methylbutyl)phenoxy]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-6-methyl-N-[[4-[4-(3-methylbutyl)phenoxy]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66843703 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-amino-6-methyl-N-[[4-[4-(3-methylbutyl)phenoxy]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCc2ccc(Oc3ccc(CCC(C)C)cc3)cc2)c(N)n1 |
| InChI | InChI=1S/C25H29N3O2/c1-17(2)4-6-19-7-11-21(12-8-19)30-22-13-9-20(10-14-22)16-27-25(29)23-15-5-18(3)28-24(23)26/h5,7-15,17H,4,6,16H2,1-3H3,(H2,26,28)(H,27,29) |
| InChIKey | TWAHXWHRQRFIIC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |