C22H23N3O4 — CID 66844101
2-amino-6-(methoxymethyl)-N-[[4-(4-methoxyphenoxy)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 66844101) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-amino-6-(methoxymethyl)-N-[[4-(4-methoxyphenoxy)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-6-(methoxymethyl)-N-[[4-(4-methoxyphenoxy)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66844101 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-amino-6-(methoxymethyl)-N-[[4-(4-methoxyphenoxy)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | COCc1ccc(C(=O)NCc2ccc(Oc3ccc(OC)cc3)cc2)c(N)n1 |
| InChI | InChI=1S/C22H23N3O4/c1-27-14-16-5-12-20(21(23)25-16)22(26)24-13-15-3-6-18(7-4-15)29-19-10-8-17(28-2)9-11-19/h3-12H,13-14H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | DKCBWZDMZMQVDY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |