C19H41N3O — CID 58105615
3-[2-aminoethyl(methyl)amino]-N-tridecylpropanamide (PubChem CID 58105615) has the molecular formula C19H41N3O and a molecular weight of 327.56 g/mol. Its IUPAC name is 3-[2-aminoethyl(methyl)amino]-N-tridecylpropanamide.
| Compound Name | 3-[2-aminoethyl(methyl)amino]-N-tridecylpropanamide |
|---|---|
| PubChem CID | 58105615 |
| Molecular Formula | C19H41N3O |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.32 |
| IUPAC Name | 3-[2-aminoethyl(methyl)amino]-N-tridecylpropanamide |
| SMILES | CCCCCCCCCCCCCNC(=O)CCN(C)CCN |
| InChI | InChI=1S/C19H41N3O/c1-3-4-5-6-7-8-9-10-11-12-13-16-21-19(23)14-17-22(2)18-15-20/h3-18,20H2,1-2H3,(H,21,23) |
| InChIKey | VBQIWSSHPWBWLQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|