C18H29NOS — CID 58107837
7-(diethylamino)-4-methyl-1-phenylsulfanylheptan-2-one (PubChem CID 58107837) has the molecular formula C18H29NOS and a molecular weight of 307.50 g/mol. Its IUPAC name is 7-(diethylamino)-4-methyl-1-phenylsulfanylheptan-2-one.
| Compound Name | 7-(diethylamino)-4-methyl-1-phenylsulfanylheptan-2-one |
|---|---|
| PubChem CID | 58107837 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 7-(diethylamino)-4-methyl-1-phenylsulfanylheptan-2-one |
| SMILES | CCN(CC)CCCC(C)CC(=O)CSc1ccccc1 |
| InChI | InChI=1S/C18H29NOS/c1-4-19(5-2)13-9-10-16(3)14-17(20)15-21-18-11-7-6-8-12-18/h6-8,11-12,16H,4-5,9-10,13-15H2,1-3H3 |
| InChIKey | RGNMUWVATUHHPV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |