C10H13O4- — CID 58108042
4-prop-2-enoyloxycyclohexane-1-carboxylate (PubChem CID 58108042) has the molecular formula C10H13O4- and a molecular weight of 197.21 g/mol. Its IUPAC name is 4-prop-2-enoyloxycyclohexane-1-carboxylate.
| Compound Name | 4-prop-2-enoyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58108042 |
| Molecular Formula | C10H13O4- |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-prop-2-enoyloxycyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OC1CCC(C(=O)[O-])CC1 |
| InChI | InChI=1S/C10H14O4/c1-2-9(11)14-8-5-3-7(4-6-8)10(12)13/h2,7-8H,1,3-6H2,(H,12,13)/p-1 |
| InChIKey | KIGNMHXYUIBIQN-UHFFFAOYSA-M |
| XLogP | 0.02 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|