C22H25BrF2N2O2 — CID 58109313
(6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-[2-(2-fluoroethylamino)ethyl]-6-(4-fluorophenyl)-1,3-oxazinan-2-one (PubChem CID 58109313) has the molecular formula C22H25BrF2N2O2 and a molecular weight of 467.35 g/mol. Its IUPAC name is (6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-[2-(2-fluoroethylamino)ethyl]-6-(4-fluorophenyl)-1,3-oxazinan-2-one.
| Compound Name | (6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-[2-(2-fluoroethylamino)ethyl]-6-(4-fluorophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 58109313 |
| Molecular Formula | C22H25BrF2N2O2 |
| Molecular Weight | 467.35 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-6-[2-(2-fluoroethylamino)ethyl]-6-(4-fluorophenyl)-1,3-oxazinan-2-one |
| SMILES | C[C@@H](c1ccc(Br)cc1)N1CC[C@](CCNCCF)(c2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C22H25BrF2N2O2/c1-16(17-2-6-19(23)7-3-17)27-15-11-22(29-21(27)28,10-13-26-14-12-24)18-4-8-20(25)9-5-18/h2-9,16,26H,10-15H2,1H3/t16-,22+/m0/s1 |
| InChIKey | RVZYAWQXQGMEPU-KSFYIVLOSA-N |
| XLogP | 5.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|