C16H17NO2S — CID 58110219
[(3S)-3-hydroxypiperidin-1-yl]-(5-phenylthiophen-3-yl)methanone (PubChem CID 58110219) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is [(3S)-3-hydroxypiperidin-1-yl]-(5-phenylthiophen-3-yl)methanone.
| Compound Name | [(3S)-3-hydroxypiperidin-1-yl]-(5-phenylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 58110219 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [(3S)-3-hydroxypiperidin-1-yl]-(5-phenylthiophen-3-yl)methanone |
| SMILES | O=C(c1csc(-c2ccccc2)c1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C16H17NO2S/c18-14-7-4-8-17(10-14)16(19)13-9-15(20-11-13)12-5-2-1-3-6-12/h1-3,5-6,9,11,14,18H,4,7-8,10H2/t14-/m0/s1 |
| InChIKey | ANKBRIQACHYTMY-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |