C26H21F3N4O — CID 58110743
3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1-[1-(3,4,5-trifluorophenyl)ethyl]pyrrolo[2,3-b]pyridine (PubChem CID 58110743) has the molecular formula C26H21F3N4O and a molecular weight of 462.48 g/mol. Its IUPAC name is 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1-[1-(3,4,5-trifluorophenyl)ethyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1-[1-(3,4,5-trifluorophenyl)ethyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58110743 |
| Molecular Formula | C26H21F3N4O |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-1-[1-(3,4,5-trifluorophenyl)ethyl]pyrrolo[2,3-b]pyridine |
| SMILES | COc1cc(-c2cn(C(C)c3cc(F)c(F)c(F)c3)c3ncccc23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H21F3N4O/c1-15-12-32(14-31-15)23-7-6-17(11-24(23)34-3)20-13-33(26-19(20)5-4-8-30-26)16(2)18-9-21(27)25(29)22(28)10-18/h4-14,16H,1-3H3 |
| InChIKey | WHSYHOYKWVUEGA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|