C12H9ClN2O4 — CID 58112575
5-chloro-6-methyl-3-[(4-nitrophenyl)methyl]-1,4-oxazin-2-one (PubChem CID 58112575) has the molecular formula C12H9ClN2O4 and a molecular weight of 280.67 g/mol. Its IUPAC name is 5-chloro-6-methyl-3-[(4-nitrophenyl)methyl]-1,4-oxazin-2-one.
| Compound Name | 5-chloro-6-methyl-3-[(4-nitrophenyl)methyl]-1,4-oxazin-2-one |
|---|---|
| PubChem CID | 58112575 |
| Molecular Formula | C12H9ClN2O4 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 5-chloro-6-methyl-3-[(4-nitrophenyl)methyl]-1,4-oxazin-2-one |
| SMILES | Cc1oc(=O)c(Cc2ccc([N+](=O)[O-])cc2)nc1Cl |
| InChI | InChI=1S/C12H9ClN2O4/c1-7-11(13)14-10(12(16)19-7)6-8-2-4-9(5-3-8)15(17)18/h2-5H,6H2,1H3 |
| InChIKey | QRLYGCLCJWHHIR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|