C20H19N5O4 — CID 163509706
2,4-bis[(4-nitrophenyl)methyl]-6-propan-2-yl-1,3,5-triazine (PubChem CID 163509706) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2,4-bis[(4-nitrophenyl)methyl]-6-propan-2-yl-1,3,5-triazine.
| Compound Name | 2,4-bis[(4-nitrophenyl)methyl]-6-propan-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 163509706 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2,4-bis[(4-nitrophenyl)methyl]-6-propan-2-yl-1,3,5-triazine |
| SMILES | CC(C)c1nc(Cc2ccc([N+](=O)[O-])cc2)nc(Cc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H19N5O4/c1-13(2)20-22-18(11-14-3-7-16(8-4-14)24(26)27)21-19(23-20)12-15-5-9-17(10-6-15)25(28)29/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | DBQVALMLOFKUTG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 124.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|