C12H9ClINO2 — CID 58112581
5-chloro-3-[(4-iodophenyl)methyl]-6-methyl-1,4-oxazin-2-one (PubChem CID 58112581) has the molecular formula C12H9ClINO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 5-chloro-3-[(4-iodophenyl)methyl]-6-methyl-1,4-oxazin-2-one.
| Compound Name | 5-chloro-3-[(4-iodophenyl)methyl]-6-methyl-1,4-oxazin-2-one |
|---|---|
| PubChem CID | 58112581 |
| Molecular Formula | C12H9ClINO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | 5-chloro-3-[(4-iodophenyl)methyl]-6-methyl-1,4-oxazin-2-one |
| SMILES | Cc1oc(=O)c(Cc2ccc(I)cc2)nc1Cl |
| InChI | InChI=1S/C12H9ClINO2/c1-7-11(13)15-10(12(16)17-7)6-8-2-4-9(14)5-3-8/h2-5H,6H2,1H3 |
| InChIKey | MAEGEYPIIQIPCH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|