C29H34F3N5O5 — CID 58118108
4-[[4-[2-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 58118108) has the molecular formula C29H34F3N5O5 and a molecular weight of 589.62 g/mol. Its IUPAC name is 4-[[4-[2-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[4-[2-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 58118108 |
| Molecular Formula | C29H34F3N5O5 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | 4-[[4-[2-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]-2-oxoethoxy]cyclohexyl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCOc1cc(NC2CCN(C(=O)COC3CCC(Nc4ccc(C#N)c(C(F)(F)F)c4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H34F3N5O5/c1-2-41-27-16-23(7-10-26(27)37(39)40)35-21-11-13-36(14-12-21)28(38)18-42-24-8-5-20(6-9-24)34-22-4-3-19(17-33)25(15-22)29(30,31)32/h3-4,7,10,15-16,20-21,24,34-35H,2,5-6,8-9,11-14,18H2,1H3 |
| InChIKey | VUVRLMVXGCJKPZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 129.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|