C11H10BrCl2N3O — CID 58118556
7-bromo-2,4-dichloro-9-methoxy-2,3,4,5-tetrahydro-1H-pyrimido[5,4-b]indole (PubChem CID 58118556) has the molecular formula C11H10BrCl2N3O and a molecular weight of 351.03 g/mol. Its IUPAC name is 7-bromo-2,4-dichloro-9-methoxy-2,3,4,5-tetrahydro-1H-pyrimido[5,4-b]indole.
| Compound Name | 7-bromo-2,4-dichloro-9-methoxy-2,3,4,5-tetrahydro-1H-pyrimido[5,4-b]indole |
|---|---|
| PubChem CID | 58118556 |
| Molecular Formula | C11H10BrCl2N3O |
| Molecular Weight | 351.03 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | 7-bromo-2,4-dichloro-9-methoxy-2,3,4,5-tetrahydro-1H-pyrimido[5,4-b]indole |
| SMILES | COc1cc(Br)cc2[nH]c3c(c12)NC(Cl)NC3Cl |
| InChI | InChI=1S/C11H10BrCl2N3O/c1-18-6-3-4(12)2-5-7(6)8-9(15-5)10(13)17-11(14)16-8/h2-3,10-11,15-17H,1H3 |
| InChIKey | SBOJCKGAKBLEOY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.03 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|