C18H18N4OS — CID 58119058
6-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-N-(4-methylphenyl)pyrimidin-4-amine (PubChem CID 58119058) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 6-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-N-(4-methylphenyl)pyrimidin-4-amine.
| Compound Name | 6-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-N-(4-methylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 58119058 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 6-[3-(amino-methylidene-oxo-λ6-sulfanyl)phenyl]-N-(4-methylphenyl)pyrimidin-4-amine |
| SMILES | C=S(N)(=O)c1cccc(-c2cc(Nc3ccc(C)cc3)ncn2)c1 |
| InChI | InChI=1S/C18H18N4OS/c1-13-6-8-15(9-7-13)22-18-11-17(20-12-21-18)14-4-3-5-16(10-14)24(2,19)23/h3-12H,2H2,1H3,(H2,19,23)(H,20,21,22) |
| InChIKey | XENHRBISPUKHOL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|