C19H21N5O2S — CID 123147947
3-[[[6-(3,5-dimethylanilino)pyrimidin-4-yl]amino]methyl]benzenesulfonamide (PubChem CID 123147947) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 3-[[[6-(3,5-dimethylanilino)pyrimidin-4-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 3-[[[6-(3,5-dimethylanilino)pyrimidin-4-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 123147947 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[[[6-(3,5-dimethylanilino)pyrimidin-4-yl]amino]methyl]benzenesulfonamide |
| SMILES | Cc1cc(C)cc(Nc2cc(NCc3cccc(S(N)(=O)=O)c3)ncn2)c1 |
| InChI | InChI=1S/C19H21N5O2S/c1-13-6-14(2)8-16(7-13)24-19-10-18(22-12-23-19)21-11-15-4-3-5-17(9-15)27(20,25)26/h3-10,12H,11H2,1-2H3,(H2,20,25,26)(H2,21,22,23,24) |
| InChIKey | MJRUNJJDCSATMH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |