C28H38N3O3S+ — CID 58119284
4-tert-butyl-N-[[4-(6-morpholin-4-ium-4-yl-2-oxohexyl)phenyl]carbamothioyl]benzamide (PubChem CID 58119284) has the molecular formula C28H38N3O3S+ and a molecular weight of 496.70 g/mol. Its IUPAC name is 4-tert-butyl-N-[[4-(6-morpholin-4-ium-4-yl-2-oxohexyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[4-(6-morpholin-4-ium-4-yl-2-oxohexyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 58119284 |
| Molecular Formula | C28H38N3O3S+ |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 4-tert-butyl-N-[[4-(6-morpholin-4-ium-4-yl-2-oxohexyl)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2ccc(CC(=O)CCCC[NH+]3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C28H37N3O3S/c1-28(2,3)23-11-9-22(10-12-23)26(33)30-27(35)29-24-13-7-21(8-14-24)20-25(32)6-4-5-15-31-16-18-34-19-17-31/h7-14H,4-6,15-20H2,1-3H3,(H2,29,30,33,35)/p+1 |
| InChIKey | JACGBSULDSTPCS-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|