C16H16BrNO6S2 — CID 58119521
2-[2-(4-bromo-3-methoxy-2-methylphenyl)-2-oxoethyl]sulfonylbenzenesulfonamide (PubChem CID 58119521) has the molecular formula C16H16BrNO6S2 and a molecular weight of 462.34 g/mol. Its IUPAC name is 2-[2-(4-bromo-3-methoxy-2-methylphenyl)-2-oxoethyl]sulfonylbenzenesulfonamide.
| Compound Name | 2-[2-(4-bromo-3-methoxy-2-methylphenyl)-2-oxoethyl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 58119521 |
| Molecular Formula | C16H16BrNO6S2 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | 2-[2-(4-bromo-3-methoxy-2-methylphenyl)-2-oxoethyl]sulfonylbenzenesulfonamide |
| SMILES | COc1c(Br)ccc(C(=O)CS(=O)(=O)c2ccccc2S(N)(=O)=O)c1C |
| InChI | InChI=1S/C16H16BrNO6S2/c1-10-11(7-8-12(17)16(10)24-2)13(19)9-25(20,21)14-5-3-4-6-15(14)26(18,22)23/h3-8H,9H2,1-2H3,(H2,18,22,23) |
| InChIKey | QRIKCZDVPVSVQR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |