C23H20N2O7S2 — CID 42610405
4-(1-benzofuran-2-yl)-3-methoxy-2-methyl-N-(2-sulfamoylphenyl)sulfonylbenzamide (PubChem CID 42610405) has the molecular formula C23H20N2O7S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-methoxy-2-methyl-N-(2-sulfamoylphenyl)sulfonylbenzamide.
| Compound Name | 4-(1-benzofuran-2-yl)-3-methoxy-2-methyl-N-(2-sulfamoylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 42610405 |
| Molecular Formula | C23H20N2O7S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-methoxy-2-methyl-N-(2-sulfamoylphenyl)sulfonylbenzamide |
| SMILES | COc1c(-c2cc3ccccc3o2)ccc(C(=O)NS(=O)(=O)c2ccccc2S(N)(=O)=O)c1C |
| InChI | InChI=1S/C23H20N2O7S2/c1-14-16(23(26)25-34(29,30)21-10-6-5-9-20(21)33(24,27)28)11-12-17(22(14)31-2)19-13-15-7-3-4-8-18(15)32-19/h3-13H,1-2H3,(H,25,26)(H2,24,27,28) |
| InChIKey | OPUCCAFTNLNQCS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |