C25H23NO7S2 — CID 58119611
2-[2-[4-(1-benzofuran-2-yl)-3-propan-2-yloxyphenyl]-2-oxoethyl]sulfonylbenzenesulfonamide (PubChem CID 58119611) has the molecular formula C25H23NO7S2 and a molecular weight of 513.59 g/mol. Its IUPAC name is 2-[2-[4-(1-benzofuran-2-yl)-3-propan-2-yloxyphenyl]-2-oxoethyl]sulfonylbenzenesulfonamide.
| Compound Name | 2-[2-[4-(1-benzofuran-2-yl)-3-propan-2-yloxyphenyl]-2-oxoethyl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 58119611 |
| Molecular Formula | C25H23NO7S2 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 2-[2-[4-(1-benzofuran-2-yl)-3-propan-2-yloxyphenyl]-2-oxoethyl]sulfonylbenzenesulfonamide |
| SMILES | CC(C)Oc1cc(C(=O)CS(=O)(=O)c2ccccc2S(N)(=O)=O)ccc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C25H23NO7S2/c1-16(2)32-22-13-17(11-12-19(22)23-14-18-7-3-4-8-21(18)33-23)20(27)15-34(28,29)24-9-5-6-10-25(24)35(26,30)31/h3-14,16H,15H2,1-2H3,(H2,26,30,31) |
| InChIKey | HZAUKGYZOVALJK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |