C14H23NO3 — CID 58120527
8-carbamoyldodeca-5,7-dien-5-yl formate (PubChem CID 58120527) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 8-carbamoyldodeca-5,7-dien-5-yl formate.
| Compound Name | 8-carbamoyldodeca-5,7-dien-5-yl formate |
|---|---|
| PubChem CID | 58120527 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 8-carbamoyldodeca-5,7-dien-5-yl formate |
| SMILES | CCCCC(=CC=C(CCCC)C(N)=O)OC=O |
| InChI | InChI=1S/C14H23NO3/c1-3-5-7-12(14(15)17)9-10-13(18-11-16)8-6-4-2/h9-11H,3-8H2,1-2H3,(H2,15,17) |
| InChIKey | MIHSMVWFKZAKQM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|