C14H30KNO5S — CID 58122631
potassium 2-[bis(1-hydroxyhexan-2-yl)amino]ethanesulfonate (PubChem CID 58122631) has the molecular formula C14H30KNO5S and a molecular weight of 363.56 g/mol. Its IUPAC name is potassium 2-[bis(1-hydroxyhexan-2-yl)amino]ethanesulfonate.
| Compound Name | potassium 2-[bis(1-hydroxyhexan-2-yl)amino]ethanesulfonate |
|---|---|
| PubChem CID | 58122631 |
| Molecular Formula | C14H30KNO5S |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | potassium 2-[bis(1-hydroxyhexan-2-yl)amino]ethanesulfonate |
| SMILES | CCCCC(CO)N(CCS(=O)(=O)[O-])C(CO)CCCC.[K+] |
| InChI | InChI=1S/C14H31NO5S.K/c1-3-5-7-13(11-16)15(9-10-21(18,19)20)14(12-17)8-6-4-2;/h13-14,16-17H,3-12H2,1-2H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | MKVQVJWAOZXBSZ-UHFFFAOYSA-M |
| XLogP | -2.06 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|