C7H7N4OY- — CID 58122992
2-amino-7-methanidyl-3H-pyrrolo[2,3-d]pyrimidin-4-one;yttrium (PubChem CID 58122992) has the molecular formula C7H7N4OY- and a molecular weight of 252.07 g/mol. Its IUPAC name is 2-amino-7-methanidyl-3H-pyrrolo[2,3-d]pyrimidin-4-one;yttrium.
| Compound Name | 2-amino-7-methanidyl-3H-pyrrolo[2,3-d]pyrimidin-4-one;yttrium |
|---|---|
| PubChem CID | 58122992 |
| Molecular Formula | C7H7N4OY- |
| Molecular Weight | 252.07 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 2-amino-7-methanidyl-3H-pyrrolo[2,3-d]pyrimidin-4-one;yttrium |
| SMILES | [CH2-]n1ccc2c(=O)[nH]c(N)nc21.[Y] |
| InChI | InChI=1S/C7H7N4O.Y/c1-11-3-2-4-5(11)9-7(8)10-6(4)12;/h2-3H,1H2,(H3,8,9,10,12);/q-1; |
| InChIKey | BCMBGOOIYBCNIP-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.07 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|