C11H15NO — CID 58125585
2-methyl-6-propan-2-yl-2,3-dihydro-1,3-benzoxazole (PubChem CID 58125585) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-methyl-6-propan-2-yl-2,3-dihydro-1,3-benzoxazole.
| Compound Name | 2-methyl-6-propan-2-yl-2,3-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 58125585 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-methyl-6-propan-2-yl-2,3-dihydro-1,3-benzoxazole |
| SMILES | CC1Nc2ccc(C(C)C)cc2O1 |
| InChI | InChI=1S/C11H15NO/c1-7(2)9-4-5-10-11(6-9)13-8(3)12-10/h4-8,12H,1-3H3 |
| InChIKey | IQDXFPDQLGNGLS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |