C8H9NRh2-2 — CID 58126753
3-propan-2-yl-2,4-dihydropyridine-2,4-diide;bis(rhodium) (PubChem CID 58126753) has the molecular formula C8H9NRh2-2 and a molecular weight of 324.98 g/mol. Its IUPAC name is 3-propan-2-yl-2,4-dihydropyridine-2,4-diide;bis(rhodium).
| Compound Name | 3-propan-2-yl-2,4-dihydropyridine-2,4-diide;bis(rhodium) |
|---|---|
| PubChem CID | 58126753 |
| Molecular Formula | C8H9NRh2-2 |
| Molecular Weight | 324.98 g/mol |
| Exact Mass | 324.89 |
| IUPAC Name | 3-propan-2-yl-2,4-dihydropyridine-2,4-diide;bis(rhodium) |
| SMILES | CC(C)c1[c-]ccn[c-]1.[Rh].[Rh] |
| InChI | InChI=1S/C8H9N.2Rh/c1-7(2)8-4-3-5-9-6-8;;/h3,5,7H,1-2H3;;/q-2;; |
| InChIKey | SESABVIPDQQRPR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.98 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|