C9H11NW2-2 — CID 59686857
3-methyl-4-propan-2-yl-2,5-dihydropyridine-2,5-diide;tungsten (PubChem CID 59686857) has the molecular formula C9H11NW2-2 and a molecular weight of 500.87 g/mol. Its IUPAC name is 3-methyl-4-propan-2-yl-2,5-dihydropyridine-2,5-diide;tungsten.
| Compound Name | 3-methyl-4-propan-2-yl-2,5-dihydropyridine-2,5-diide;tungsten |
|---|---|
| PubChem CID | 59686857 |
| Molecular Formula | C9H11NW2-2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.99 |
| IUPAC Name | 3-methyl-4-propan-2-yl-2,5-dihydropyridine-2,5-diide;tungsten |
| SMILES | Cc1[c-]nc[c-]c1C(C)C.[W].[W] |
| InChI | InChI=1S/C9H11N.2W/c1-7(2)9-4-5-10-6-8(9)3;;/h5,7H,1-3H3;;/q-2;; |
| InChIKey | QKHPVIDTIMTBCL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|