C8H9NW2-2 — CID 59184821
4-propan-2-yl-2,5-dihydropyridine-2,5-diide;tungsten (PubChem CID 59184821) has the molecular formula C8H9NW2-2 and a molecular weight of 486.85 g/mol. Its IUPAC name is 4-propan-2-yl-2,5-dihydropyridine-2,5-diide;tungsten.
| Compound Name | 4-propan-2-yl-2,5-dihydropyridine-2,5-diide;tungsten |
|---|---|
| PubChem CID | 59184821 |
| Molecular Formula | C8H9NW2-2 |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | 4-propan-2-yl-2,5-dihydropyridine-2,5-diide;tungsten |
| SMILES | CC(C)c1[c-]cn[c-]c1.[W].[W] |
| InChI | InChI=1S/C8H9N.2W/c1-7(2)8-3-5-9-6-4-8;;/h3,6-7H,1-2H3;;/q-2;; |
| InChIKey | OUSMLLGBHVNVMQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|