C21H20ClF2N3O — CID 58127285
4-[5-chloro-4-[6-[(3,5-difluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]butan-1-ol (PubChem CID 58127285) has the molecular formula C21H20ClF2N3O and a molecular weight of 403.86 g/mol. Its IUPAC name is 4-[5-chloro-4-[6-[(3,5-difluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]butan-1-ol.
| Compound Name | 4-[5-chloro-4-[6-[(3,5-difluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]butan-1-ol |
|---|---|
| PubChem CID | 58127285 |
| Molecular Formula | C21H20ClF2N3O |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 4-[5-chloro-4-[6-[(3,5-difluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]butan-1-ol |
| SMILES | OCCCCc1cc(-c2cccc(NCc3cc(F)cc(F)c3)n2)c(Cl)cn1 |
| InChI | InChI=1S/C21H20ClF2N3O/c22-19-13-25-17(4-1-2-7-28)11-18(19)20-5-3-6-21(27-20)26-12-14-8-15(23)10-16(24)9-14/h3,5-6,8-11,13,28H,1-2,4,7,12H2,(H,26,27) |
| InChIKey | CIVWZMZVUUNSHY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|