C29H23ClN4O3S — CID 58129149
4-[[(4-chlorophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]-N-quinolin-6-ylbenzamide (PubChem CID 58129149) has the molecular formula C29H23ClN4O3S and a molecular weight of 543.05 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]-N-quinolin-6-ylbenzamide.
| Compound Name | 4-[[(4-chlorophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]-N-quinolin-6-ylbenzamide |
|---|---|
| PubChem CID | 58129149 |
| Molecular Formula | C29H23ClN4O3S |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 4-[[(4-chlorophenyl)sulfonyl-(pyridin-2-ylmethyl)amino]methyl]-N-quinolin-6-ylbenzamide |
| SMILES | O=C(Nc1ccc2ncccc2c1)c1ccc(CN(Cc2ccccn2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H23ClN4O3S/c30-24-10-13-27(14-11-24)38(36,37)34(20-26-5-1-2-16-31-26)19-21-6-8-22(9-7-21)29(35)33-25-12-15-28-23(18-25)4-3-17-32-28/h1-18H,19-20H2,(H,33,35) |
| InChIKey | WQZKVUPJGXUIMU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |