C29H27ClN4O3S — CID 159017401
2-(3-chlorophenyl)-N-[4-[[[4-(methyliminomethyl)phenyl]sulfonyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]acetamide (PubChem CID 159017401) has the molecular formula C29H27ClN4O3S and a molecular weight of 547.08 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[4-[[[4-(methyliminomethyl)phenyl]sulfonyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[4-[[[4-(methyliminomethyl)phenyl]sulfonyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 159017401 |
| Molecular Formula | C29H27ClN4O3S |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[4-[[[4-(methyliminomethyl)phenyl]sulfonyl-(pyridin-2-ylmethyl)amino]methyl]phenyl]acetamide |
| SMILES | C/N=C/c1ccc(S(=O)(=O)N(Cc2ccc(NC(=O)Cc3cccc(Cl)c3)cc2)Cc2ccccn2)cc1 |
| InChI | InChI=1S/C29H27ClN4O3S/c1-31-19-22-10-14-28(15-11-22)38(36,37)34(21-27-7-2-3-16-32-27)20-23-8-12-26(13-9-23)33-29(35)18-24-5-4-6-25(30)17-24/h2-17,19H,18,20-21H2,1H3,(H,33,35)/b31-19+ |
| InChIKey | JTGNLWBKWCZJQW-ZCTHSVRISA-N |
| XLogP | 5.36 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|