C18H29NO — CID 58129534
5-(2-adamantylamino)-2,2-dimethylhex-5-en-3-one (PubChem CID 58129534) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 5-(2-adamantylamino)-2,2-dimethylhex-5-en-3-one.
| Compound Name | 5-(2-adamantylamino)-2,2-dimethylhex-5-en-3-one |
|---|---|
| PubChem CID | 58129534 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 5-(2-adamantylamino)-2,2-dimethylhex-5-en-3-one |
| SMILES | C=C(CC(=O)C(C)(C)C)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H29NO/c1-11(5-16(20)18(2,3)4)19-17-14-7-12-6-13(9-14)10-15(17)8-12/h12-15,17,19H,1,5-10H2,2-4H3 |
| InChIKey | PFOHULVLQIWOHE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |