C15H15ClN4Pt — CID 58130228
chloroplatinum(1+);3,5-dimethyl-1-[3-(1-methylimidazol-2-yl)benzene-2-id-1-yl]pyrazole (PubChem CID 58130228) has the molecular formula C15H15ClN4Pt and a molecular weight of 481.84 g/mol. Its IUPAC name is chloroplatinum(1+);3,5-dimethyl-1-[3-(1-methylimidazol-2-yl)benzene-2-id-1-yl]pyrazole.
| Compound Name | chloroplatinum(1+);3,5-dimethyl-1-[3-(1-methylimidazol-2-yl)benzene-2-id-1-yl]pyrazole |
|---|---|
| PubChem CID | 58130228 |
| Molecular Formula | C15H15ClN4Pt |
| Molecular Weight | 481.84 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | chloroplatinum(1+);3,5-dimethyl-1-[3-(1-methylimidazol-2-yl)benzene-2-id-1-yl]pyrazole |
| SMILES | Cc1cc(C)n(-c2[c-]c(-c3nccn3C)ccc2)n1.Cl[Pt+] |
| InChI | InChI=1S/C15H15N4.ClH.Pt/c1-11-9-12(2)19(17-11)14-6-4-5-13(10-14)15-16-7-8-18(15)3;;/h4-9H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | MODGNLYDBJYQJT-UHFFFAOYSA-M |
| XLogP | 3.38 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|