C14H14ClN5Pt — CID 58130233
chloroplatinum(1+);3-(3,5-dimethylpyrazol-1-yl)-5-(1-methylimidazol-2-yl)-4H-pyridin-4-ide (PubChem CID 58130233) has the molecular formula C14H14ClN5Pt and a molecular weight of 482.83 g/mol. Its IUPAC name is chloroplatinum(1+);3-(3,5-dimethylpyrazol-1-yl)-5-(1-methylimidazol-2-yl)-4H-pyridin-4-ide.
| Compound Name | chloroplatinum(1+);3-(3,5-dimethylpyrazol-1-yl)-5-(1-methylimidazol-2-yl)-4H-pyridin-4-ide |
|---|---|
| PubChem CID | 58130233 |
| Molecular Formula | C14H14ClN5Pt |
| Molecular Weight | 482.83 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | chloroplatinum(1+);3-(3,5-dimethylpyrazol-1-yl)-5-(1-methylimidazol-2-yl)-4H-pyridin-4-ide |
| SMILES | Cc1cc(C)n(-c2[c-]c(-c3nccn3C)cnc2)n1.Cl[Pt+] |
| InChI | InChI=1S/C14H14N5.ClH.Pt/c1-10-6-11(2)19(17-10)13-7-12(8-15-9-13)14-16-4-5-18(14)3;;/h4-6,8-9H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | PWBMGQJCBFJDMB-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|