C6H9N2Y- — CID 58130771
1,2,5-trimethyl-4H-imidazol-4-ide;yttrium (PubChem CID 58130771) has the molecular formula C6H9N2Y- and a molecular weight of 198.06 g/mol. Its IUPAC name is 1,2,5-trimethyl-4H-imidazol-4-ide;yttrium.
| Compound Name | 1,2,5-trimethyl-4H-imidazol-4-ide;yttrium |
|---|---|
| PubChem CID | 58130771 |
| Molecular Formula | C6H9N2Y- |
| Molecular Weight | 198.06 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 1,2,5-trimethyl-4H-imidazol-4-ide;yttrium |
| SMILES | Cc1[c-]nc(C)n1C.[Y] |
| InChI | InChI=1S/C6H9N2.Y/c1-5-4-7-6(2)8(5)3;/h1-3H3;/q-1; |
| InChIKey | QJTOBBPTCXZMFY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.06 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|