C7H12N2Ru+ — CID 59997625
ruthenium(1+);1,2,3,5-tetramethyl-4H-imidazol-3-ium-4-ide (PubChem CID 59997625) has the molecular formula C7H12N2Ru+ and a molecular weight of 225.26 g/mol. Its IUPAC name is ruthenium(1+);1,2,3,5-tetramethyl-4H-imidazol-3-ium-4-ide.
| Compound Name | ruthenium(1+);1,2,3,5-tetramethyl-4H-imidazol-3-ium-4-ide |
|---|---|
| PubChem CID | 59997625 |
| Molecular Formula | C7H12N2Ru+ |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | ruthenium(1+);1,2,3,5-tetramethyl-4H-imidazol-3-ium-4-ide |
| SMILES | Cc1[c-][n+](C)c(C)n1C.[Ru+] |
| InChI | InChI=1S/C7H12N2.Ru/c1-6-5-8(3)7(2)9(6)4;/h1-4H3;/q;+1 |
| InChIKey | QQODCXLLMXHTIX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|