C73H52N2S2 — CID 58131714
4-(9,9-dimethyl-1,2,3-triphenylindeno[1,2-f]indol-7-yl)-N,N-bis[4-(5-phenylthiophen-2-yl)phenyl]aniline (PubChem CID 58131714) has the molecular formula C73H52N2S2 and a molecular weight of 1021.37 g/mol. Its IUPAC name is 4-(9,9-dimethyl-1,2,3-triphenylindeno[1,2-f]indol-7-yl)-N,N-bis[4-(5-phenylthiophen-2-yl)phenyl]aniline.
| Compound Name | 4-(9,9-dimethyl-1,2,3-triphenylindeno[1,2-f]indol-7-yl)-N,N-bis[4-(5-phenylthiophen-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 58131714 |
| Molecular Formula | C73H52N2S2 |
| Molecular Weight | 1021.37 g/mol |
| Exact Mass | 1020.36 |
| IUPAC Name | 4-(9,9-dimethyl-1,2,3-triphenylindeno[1,2-f]indol-7-yl)-N,N-bis[4-(5-phenylthiophen-2-yl)phenyl]aniline |
| SMILES | CC1(C)c2cc(-c3ccc(N(c4ccc(-c5ccc(-c6ccccc6)s5)cc4)c4ccc(-c5ccc(-c6ccccc6)s5)cc4)cc3)ccc2-c2cc3c(-c4ccccc4)c(-c4ccccc4)n(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C73H52N2S2/c1-73(2)64-46-56(34-41-61(64)62-47-63-66(48-65(62)73)75(57-26-16-7-17-27-57)72(55-24-14-6-15-25-55)71(63)54-22-12-5-13-23-54)49-28-35-58(36-29-49)74(59-37-30-52(31-38-59)69-44-42-67(76-69)50-18-8-3-9-19-50)60-39-32-53(33-40-60)70-45-43-68(77-70)51-20-10-4-11-21-51/h3-48H,1-2H3 |
| InChIKey | FITDOBKRFIIMSA-UHFFFAOYSA-N |
| XLogP | 21.20 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.37 |
| LogP ≤ 5 | 21.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |