C64H50N2 — CID 89408857
7-[(E)-1,2-dideuterio-2-(9,9-dimethyl-1,2,3-triphenylindeno[1,2-f]indol-7-yl)ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine (PubChem CID 89408857) has the molecular formula C64H50N2 and a molecular weight of 849.13 g/mol. Its IUPAC name is 7-[(E)-1,2-dideuterio-2-(9,9-dimethyl-1,2,3-triphenylindeno[1,2-f]indol-7-yl)ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine.
| Compound Name | 7-[(E)-1,2-dideuterio-2-(9,9-dimethyl-1,2,3-triphenylindeno[1,2-f]indol-7-yl)ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 89408857 |
| Molecular Formula | C64H50N2 |
| Molecular Weight | 849.13 g/mol |
| Exact Mass | 848.41 |
| IUPAC Name | 7-[(E)-1,2-dideuterio-2-(9,9-dimethyl-1,2,3-triphenylindeno[1,2-f]indol-7-yl)ethenyl]-9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| SMILES | [2H]/C(=C(/[2H])c1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)c(-c1ccccc1)c(-c1ccccc1)n3-c1ccccc1)c1ccc2c(c1)C(C)(C)c1cc(N(c3ccccc3)c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C64H50N2/c1-63(2)56-38-43(32-35-51(56)52-37-34-50(40-58(52)63)65(47-24-14-7-15-25-47)48-26-16-8-17-27-48)30-31-44-33-36-53-54-41-55-60(42-59(54)64(3,4)57(53)39-44)66(49-28-18-9-19-29-49)62(46-22-12-6-13-23-46)61(55)45-20-10-5-11-21-45/h5-42H,1-4H3/b31-30+/i30D,31D |
| InChIKey | YPZLGQVRHQTBRS-MNPTUUBLSA-N |
| XLogP | 17.22 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.13 |
| LogP ≤ 5 | 17.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|