C23H19NO5S — CID 58133199
4-methoxy-2-[4-(4-methoxyphenyl)sulfonylphenoxy]quinoline (PubChem CID 58133199) has the molecular formula C23H19NO5S and a molecular weight of 421.47 g/mol. Its IUPAC name is 4-methoxy-2-[4-(4-methoxyphenyl)sulfonylphenoxy]quinoline.
| Compound Name | 4-methoxy-2-[4-(4-methoxyphenyl)sulfonylphenoxy]quinoline |
|---|---|
| PubChem CID | 58133199 |
| Molecular Formula | C23H19NO5S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-methoxy-2-[4-(4-methoxyphenyl)sulfonylphenoxy]quinoline |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(Oc3cc(OC)c4ccccc4n3)cc2)cc1 |
| InChI | InChI=1S/C23H19NO5S/c1-27-16-7-11-18(12-8-16)30(25,26)19-13-9-17(10-14-19)29-23-15-22(28-2)20-5-3-4-6-21(20)24-23/h3-15H,1-2H3 |
| InChIKey | YOIFERWVYBQLGN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |