C24H27N3O6S — CID 58133624
3-[3-(2-methoxyethylcarbamoyl)phenoxy]-5-[(2S)-1-methoxypropan-2-yl]oxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 58133624) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is 3-[3-(2-methoxyethylcarbamoyl)phenoxy]-5-[(2S)-1-methoxypropan-2-yl]oxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[3-(2-methoxyethylcarbamoyl)phenoxy]-5-[(2S)-1-methoxypropan-2-yl]oxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 58133624 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 3-[3-(2-methoxyethylcarbamoyl)phenoxy]-5-[(2S)-1-methoxypropan-2-yl]oxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COCCNC(=O)c1cccc(Oc2cc(O[C@@H](C)COC)cc(C(=O)Nc3nccs3)c2)c1 |
| InChI | InChI=1S/C24H27N3O6S/c1-16(15-31-3)32-20-12-18(23(29)27-24-26-8-10-34-24)13-21(14-20)33-19-6-4-5-17(11-19)22(28)25-7-9-30-2/h4-6,8,10-14,16H,7,9,15H2,1-3H3,(H,25,28)(H,26,27,29)/t16-/m0/s1 |
| InChIKey | TTZRPOQBBWTXJU-INIZCTEOSA-N |
| XLogP | 3.98 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|