C22H21FN2O3S — CID 87349177
3-[(E)-2-(4-fluorophenyl)ethenyl]-5-[(2S)-1-methoxypropan-2-yl]oxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 87349177) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[(E)-2-(4-fluorophenyl)ethenyl]-5-[(2S)-1-methoxypropan-2-yl]oxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[(E)-2-(4-fluorophenyl)ethenyl]-5-[(2S)-1-methoxypropan-2-yl]oxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 87349177 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 3-[(E)-2-(4-fluorophenyl)ethenyl]-5-[(2S)-1-methoxypropan-2-yl]oxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COC[C@H](C)Oc1cc(/C=C/c2ccc(F)cc2)cc(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C22H21FN2O3S/c1-15(14-27-2)28-20-12-17(4-3-16-5-7-19(23)8-6-16)11-18(13-20)21(26)25-22-24-9-10-29-22/h3-13,15H,14H2,1-2H3,(H,24,25,26)/b4-3+/t15-/m0/s1 |
| InChIKey | LIGXWZAFXKMKPS-BWPKMQGJSA-N |
| XLogP | 5.12 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|