C22H18F4N2O3S — CID 87349451
N-(5-fluoro-1,3-thiazol-2-yl)-3-[(2S)-1-methoxypropan-2-yl]oxy-5-[(E)-2-(2,3,5-trifluorophenyl)ethenyl]benzamide (PubChem CID 87349451) has the molecular formula C22H18F4N2O3S and a molecular weight of 466.46 g/mol. Its IUPAC name is N-(5-fluoro-1,3-thiazol-2-yl)-3-[(2S)-1-methoxypropan-2-yl]oxy-5-[(E)-2-(2,3,5-trifluorophenyl)ethenyl]benzamide.
| Compound Name | N-(5-fluoro-1,3-thiazol-2-yl)-3-[(2S)-1-methoxypropan-2-yl]oxy-5-[(E)-2-(2,3,5-trifluorophenyl)ethenyl]benzamide |
|---|---|
| PubChem CID | 87349451 |
| Molecular Formula | C22H18F4N2O3S |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-(5-fluoro-1,3-thiazol-2-yl)-3-[(2S)-1-methoxypropan-2-yl]oxy-5-[(E)-2-(2,3,5-trifluorophenyl)ethenyl]benzamide |
| SMILES | COC[C@H](C)Oc1cc(/C=C/c2cc(F)cc(F)c2F)cc(C(=O)Nc2ncc(F)s2)c1 |
| InChI | InChI=1S/C22H18F4N2O3S/c1-12(11-30-2)31-17-6-13(3-4-14-7-16(23)9-18(24)20(14)26)5-15(8-17)21(29)28-22-27-10-19(25)32-22/h3-10,12H,11H2,1-2H3,(H,27,28,29)/b4-3+/t12-/m0/s1 |
| InChIKey | IRQARAMCHCYZHD-PCAWENJQSA-N |
| XLogP | 5.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|