C19H24N2O4S — CID 87419524
N-[5-(hydroperoxymethyl)-1,3-thiazol-2-yl]-3-[(Z)-3-methylbut-1-enyl]-5-propan-2-yloxybenzamide (PubChem CID 87419524) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[5-(hydroperoxymethyl)-1,3-thiazol-2-yl]-3-[(Z)-3-methylbut-1-enyl]-5-propan-2-yloxybenzamide.
| Compound Name | N-[5-(hydroperoxymethyl)-1,3-thiazol-2-yl]-3-[(Z)-3-methylbut-1-enyl]-5-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 87419524 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[5-(hydroperoxymethyl)-1,3-thiazol-2-yl]-3-[(Z)-3-methylbut-1-enyl]-5-propan-2-yloxybenzamide |
| SMILES | CC(C)/C=C\c1cc(OC(C)C)cc(C(=O)Nc2ncc(COO)s2)c1 |
| InChI | InChI=1S/C19H24N2O4S/c1-12(2)5-6-14-7-15(9-16(8-14)25-13(3)4)18(22)21-19-20-10-17(26-19)11-24-23/h5-10,12-13,23H,11H2,1-4H3,(H,20,21,22)/b6-5- |
| InChIKey | XLRPIVOCRNEWQH-WAYWQWQTSA-N |
| XLogP | 4.84 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|